About 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide
1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide (PubChem CID 128985956) has the molecular formula C16H20Cl2N2O3
and a molecular weight of 359.25 g/mol. Its IUPAC name is 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide |
| PubChem CID | 128985956 |
| Molecular Formula | C16H20Cl2N2O3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide |
| SMILES | CC(=O)N1CCCC(O)(C(=O)N(C)Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H20Cl2N2O3/c1-11(21)20-7-3-6-16(23,10-20)15(22)19(2)9-12-4-5-13(17)14(18)8-12/h4-5,8,23H,3,6-7,9-10H2,1-2H3 |
| InChIKey | NMJJDGBKKBAKLQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide?
The IUPAC name of 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide (CID 128985956) is 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide.
What is the SMILES notation for 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide?
The canonical SMILES for 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide is CC(=O)N1CCCC(O)(C(=O)N(C)Cc2ccc(Cl)c(Cl)c2)C1.
What is the InChIKey of 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide?
The InChIKey is NMJJDGBKKBAKLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Cl2N2O3/c1-11(21)20-7-3-6-16(23,10-20)15(22)19(2)9-12-4-5-13(17)14(18)8-12/h4-5,8,23H,3,6-7,9-10H2,1-2H3.
What are the key properties of 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide?
1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide has a molecular weight of 359.25 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-N-[(3,4-dichlorophenyl)methyl]-3-hydroxy-N-methylpiperidine-3-carboxamide is sourced from PubChem (CID 128985956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).