C17H27N3O3 — CID 128986230
2-cyclohexyloxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]acetamide (PubChem CID 128986230) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-cyclohexyloxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]acetamide.
| Compound Name | 2-cyclohexyloxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 128986230 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 2-cyclohexyloxy-N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxolan-3-yl]acetamide |
| SMILES | CCn1ccnc1[C@H]1OCC[C@@H]1NC(=O)COC1CCCCC1 |
| InChI | InChI=1S/C17H27N3O3/c1-2-20-10-9-18-17(20)16-14(8-11-22-16)19-15(21)12-23-13-6-4-3-5-7-13/h9-10,13-14,16H,2-8,11-12H2,1H3,(H,19,21)/t14-,16-/m0/s1 |
| InChIKey | GPRSTLSXOFDUOJ-HOCLYGCPSA-N |
| XLogP | 2.20 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |