C14H8BrF3N2O — CID 12898686
N-[4-bromo-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-amine (PubChem CID 12898686) has the molecular formula C14H8BrF3N2O and a molecular weight of 357.13 g/mol. Its IUPAC name is N-[4-bromo-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 12898686 |
| Molecular Formula | C14H8BrF3N2O |
| Molecular Weight | 357.13 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | N-[4-bromo-3-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-amine |
| SMILES | FC(F)(F)c1cc(Nc2nc3ccccc3o2)ccc1Br |
| InChI | InChI=1S/C14H8BrF3N2O/c15-10-6-5-8(7-9(10)14(16,17)18)19-13-20-11-3-1-2-4-12(11)21-13/h1-7H,(H,19,20) |
| InChIKey | ONNYBKFKMIWACT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.13 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |