C19H23FN4O2 — CID 128987659
(4R,5R)-1-cyclopropyl-4-[2-(4-fluorophenoxy)ethylamino]-5-(2-methylpyrazol-3-yl)pyrrolidin-2-one (PubChem CID 128987659) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is (4R,5R)-1-cyclopropyl-4-[2-(4-fluorophenoxy)ethylamino]-5-(2-methylpyrazol-3-yl)pyrrolidin-2-one.
| Compound Name | (4R,5R)-1-cyclopropyl-4-[2-(4-fluorophenoxy)ethylamino]-5-(2-methylpyrazol-3-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 128987659 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (4R,5R)-1-cyclopropyl-4-[2-(4-fluorophenoxy)ethylamino]-5-(2-methylpyrazol-3-yl)pyrrolidin-2-one |
| SMILES | Cn1nccc1[C@H]1[C@H](NCCOc2ccc(F)cc2)CC(=O)N1C1CC1 |
| InChI | InChI=1S/C19H23FN4O2/c1-23-17(8-9-22-23)19-16(12-18(25)24(19)14-4-5-14)21-10-11-26-15-6-2-13(20)3-7-15/h2-3,6-9,14,16,19,21H,4-5,10-12H2,1H3/t16-,19-/m1/s1 |
| InChIKey | JWFYBJHALLPSFU-VQIMIIECSA-N |
| XLogP | 2.03 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|