C10H18FNO3 — CID 128988534
1-[(2S,4S)-4-fluoro-2-(hydroxymethyl)pyrrolidin-1-yl]-2-propoxyethanone (PubChem CID 128988534) has the molecular formula C10H18FNO3 and a molecular weight of 219.26 g/mol. Its IUPAC name is 1-[(2S,4S)-4-fluoro-2-(hydroxymethyl)pyrrolidin-1-yl]-2-propoxyethanone.
| Compound Name | 1-[(2S,4S)-4-fluoro-2-(hydroxymethyl)pyrrolidin-1-yl]-2-propoxyethanone |
|---|---|
| PubChem CID | 128988534 |
| Molecular Formula | C10H18FNO3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-[(2S,4S)-4-fluoro-2-(hydroxymethyl)pyrrolidin-1-yl]-2-propoxyethanone |
| SMILES | CCCOCC(=O)N1C[C@@H](F)C[C@H]1CO |
| InChI | InChI=1S/C10H18FNO3/c1-2-3-15-7-10(14)12-5-8(11)4-9(12)6-13/h8-9,13H,2-7H2,1H3/t8-,9-/m0/s1 |
| InChIKey | URJFYSRMFRVLIW-IUCAKERBSA-N |
| XLogP | 0.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|