C15H23F3N2O2 — CID 128989550
N-[1-(3-ethylpent-2-enoyl)-6-(trifluoromethyl)piperidin-3-yl]acetamide (PubChem CID 128989550) has the molecular formula C15H23F3N2O2 and a molecular weight of 320.36 g/mol. Its IUPAC name is N-[1-(3-ethylpent-2-enoyl)-6-(trifluoromethyl)piperidin-3-yl]acetamide.
| Compound Name | N-[1-(3-ethylpent-2-enoyl)-6-(trifluoromethyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 128989550 |
| Molecular Formula | C15H23F3N2O2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-[1-(3-ethylpent-2-enoyl)-6-(trifluoromethyl)piperidin-3-yl]acetamide |
| SMILES | CCC(=CC(=O)N1CC(NC(C)=O)CCC1C(F)(F)F)CC |
| InChI | InChI=1S/C15H23F3N2O2/c1-4-11(5-2)8-14(22)20-9-12(19-10(3)21)6-7-13(20)15(16,17)18/h8,12-13H,4-7,9H2,1-3H3,(H,19,21) |
| InChIKey | HKZJAAWRGCGPCP-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|