C16H18F4N2O2 — CID 128989597
N-[1-(2-fluoro-3-methylbenzoyl)-6-(trifluoromethyl)piperidin-3-yl]acetamide (PubChem CID 128989597) has the molecular formula C16H18F4N2O2 and a molecular weight of 346.32 g/mol. Its IUPAC name is N-[1-(2-fluoro-3-methylbenzoyl)-6-(trifluoromethyl)piperidin-3-yl]acetamide.
| Compound Name | N-[1-(2-fluoro-3-methylbenzoyl)-6-(trifluoromethyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 128989597 |
| Molecular Formula | C16H18F4N2O2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N-[1-(2-fluoro-3-methylbenzoyl)-6-(trifluoromethyl)piperidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCC(C(F)(F)F)N(C(=O)c2cccc(C)c2F)C1 |
| InChI | InChI=1S/C16H18F4N2O2/c1-9-4-3-5-12(14(9)17)15(24)22-8-11(21-10(2)23)6-7-13(22)16(18,19)20/h3-5,11,13H,6-8H2,1-2H3,(H,21,23) |
| InChIKey | UCVFPWUWFJKWRL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |