C13H14ClF2NO3 — CID 128990376
(2-chloro-4,5-difluorophenyl)-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methanone (PubChem CID 128990376) has the molecular formula C13H14ClF2NO3 and a molecular weight of 305.71 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 128990376 |
| Molecular Formula | C13H14ClF2NO3 |
| Molecular Weight | 305.71 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-[(2S,4R)-2-(hydroxymethyl)-4-methoxypyrrolidin-1-yl]methanone |
| SMILES | CO[C@@H]1C[C@@H](CO)N(C(=O)c2cc(F)c(F)cc2Cl)C1 |
| InChI | InChI=1S/C13H14ClF2NO3/c1-20-8-2-7(6-18)17(5-8)13(19)9-3-11(15)12(16)4-10(9)14/h3-4,7-8,18H,2,5-6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | PULPPWNCZFGSFI-JGVFFNPUSA-N |
| XLogP | 1.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.71 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|