About 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide
5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide (PubChem CID 128990513) has the molecular formula C17H19N5O2
and a molecular weight of 325.37 g/mol. Its IUPAC name is 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide |
| PubChem CID | 128990513 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@H]2CCO[C@@H]2c2ccnn2C)c2[nH]ncc2c1 |
| InChI | InChI=1S/C17H19N5O2/c1-10-7-11-9-18-21-15(11)12(8-10)17(23)20-13-4-6-24-16(13)14-3-5-19-22(14)2/h3,5,7-9,13,16H,4,6H2,1-2H3,(H,18,21)(H,20,23)/t13-,16-/m0/s1 |
| InChIKey | WNGMWLWGMDPRNH-BBRMVZONSA-N |
| XLogP | 1.86 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide?
The IUPAC name of 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide (CID 128990513) is 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide.
What is the SMILES notation for 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide?
The canonical SMILES for 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide is Cc1cc(C(=O)N[C@H]2CCO[C@@H]2c2ccnn2C)c2[nH]ncc2c1.
What is the InChIKey of 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide?
The InChIKey is WNGMWLWGMDPRNH-BBRMVZONSA-N. The full InChI is InChI=1S/C17H19N5O2/c1-10-7-11-9-18-21-15(11)12(8-10)17(23)20-13-4-6-24-16(13)14-3-5-19-22(14)2/h3,5,7-9,13,16H,4,6H2,1-2H3,(H,18,21)(H,20,23)/t13-,16-/m0/s1.
What are the key properties of 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide?
5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide has a molecular weight of 325.37 g/mol, XLogP of 1.86, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-[(2S,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]-1H-indazole-7-carboxamide is sourced from PubChem (CID 128990513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).