C20H22N6O — CID 128990864
[3-[(4-aminopyrimidin-2-yl)methyl-methylamino]pyrrolidin-1-yl]-quinolin-6-ylmethanone (PubChem CID 128990864) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is [3-[(4-aminopyrimidin-2-yl)methyl-methylamino]pyrrolidin-1-yl]-quinolin-6-ylmethanone.
| Compound Name | [3-[(4-aminopyrimidin-2-yl)methyl-methylamino]pyrrolidin-1-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 128990864 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | [3-[(4-aminopyrimidin-2-yl)methyl-methylamino]pyrrolidin-1-yl]-quinolin-6-ylmethanone |
| SMILES | CN(Cc1nccc(N)n1)C1CCN(C(=O)c2ccc3ncccc3c2)C1 |
| InChI | InChI=1S/C20H22N6O/c1-25(13-19-23-9-6-18(21)24-19)16-7-10-26(12-16)20(27)15-4-5-17-14(11-15)3-2-8-22-17/h2-6,8-9,11,16H,7,10,12-13H2,1H3,(H2,21,23,24) |
| InChIKey | TXKQCCUSQMDOLD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |