About 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one
8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 12899140) has the molecular formula C9H8ClNO2
and a molecular weight of 197.62 g/mol. Its IUPAC name is 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 12899140 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2c(O)ccc(Cl)c2N1 |
| InChI | InChI=1S/C9H8ClNO2/c10-6-2-3-7(12)5-1-4-8(13)11-9(5)6/h2-3,12H,1,4H2,(H,11,13) |
| InChIKey | JBLUTMBJJMMYRZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one (CID 12899140) is 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one is O=C1CCc2c(O)ccc(Cl)c2N1.
What is the InChIKey of 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is JBLUTMBJJMMYRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO2/c10-6-2-3-7(12)5-1-4-8(13)11-9(5)6/h2-3,12H,1,4H2,(H,11,13).
What are the key properties of 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one?
8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 197.62 g/mol, XLogP of 1.93, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 12899140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).