C14H18F3N5O2 — CID 128991938
2-ethyl-5-[[2-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methyl]-1,3,4-oxadiazole (PubChem CID 128991938) has the molecular formula C14H18F3N5O2 and a molecular weight of 345.33 g/mol. Its IUPAC name is 2-ethyl-5-[[2-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methyl]-1,3,4-oxadiazole.
| Compound Name | 2-ethyl-5-[[2-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 128991938 |
| Molecular Formula | C14H18F3N5O2 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-ethyl-5-[[2-[5-(2,2,2-trifluoroethyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methyl]-1,3,4-oxadiazole |
| SMILES | CCc1nnc(CN2CCCCC2c2nnc(CC(F)(F)F)o2)o1 |
| InChI | InChI=1S/C14H18F3N5O2/c1-2-10-18-20-12(23-10)8-22-6-4-3-5-9(22)13-21-19-11(24-13)7-14(15,16)17/h9H,2-8H2,1H3 |
| InChIKey | PGOQGDPTYYZSBJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |