C18H26N4O3 — CID 128992413
1-[2-[3-[[2-(dimethylamino)-3-pyridinyl]oxy]pyrrolidin-1-yl]-2-oxoethyl]piperidin-2-one (PubChem CID 128992413) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[2-[3-[[2-(dimethylamino)-3-pyridinyl]oxy]pyrrolidin-1-yl]-2-oxoethyl]piperidin-2-one.
| Compound Name | 1-[2-[3-[[2-(dimethylamino)-3-pyridinyl]oxy]pyrrolidin-1-yl]-2-oxoethyl]piperidin-2-one |
|---|---|
| PubChem CID | 128992413 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 1-[2-[3-[[2-(dimethylamino)-3-pyridinyl]oxy]pyrrolidin-1-yl]-2-oxoethyl]piperidin-2-one |
| SMILES | CN(C)c1ncccc1OC1CCN(C(=O)CN2CCCCC2=O)C1 |
| InChI | InChI=1S/C18H26N4O3/c1-20(2)18-15(6-5-9-19-18)25-14-8-11-22(12-14)17(24)13-21-10-4-3-7-16(21)23/h5-6,9,14H,3-4,7-8,10-13H2,1-2H3 |
| InChIKey | HMJLXBIQGXBOOJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |