About 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one
6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 12899417) has the molecular formula C9H7Cl2NO2
and a molecular weight of 232.07 g/mol. Its IUPAC name is 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 12899417 |
| Molecular Formula | C9H7Cl2NO2 |
| Molecular Weight | 232.07 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2c(O)c(Cl)cc(Cl)c2N1 |
| InChI | InChI=1S/C9H7Cl2NO2/c10-5-3-6(11)9(14)4-1-2-7(13)12-8(4)5/h3,14H,1-2H2,(H,12,13) |
| InChIKey | OGHVHWURQPBPBZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.07 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one (CID 12899417) is 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one is O=C1CCc2c(O)c(Cl)cc(Cl)c2N1.
What is the InChIKey of 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is OGHVHWURQPBPBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7Cl2NO2/c10-5-3-6(11)9(14)4-1-2-7(13)12-8(4)5/h3,14H,1-2H2,(H,12,13).
What are the key properties of 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one?
6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 232.07 g/mol, XLogP of 2.58, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-5-hydroxy-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 12899417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).