C17H30N4 — CID 128994586
N,3-dimethyl-N-[[(2R,3S)-1-methyl-2-(1-methylpyrazol-4-yl)piperidin-3-yl]methyl]but-2-en-1-amine (PubChem CID 128994586) has the molecular formula C17H30N4 and a molecular weight of 290.46 g/mol. Its IUPAC name is N,3-dimethyl-N-[[(2R,3S)-1-methyl-2-(1-methylpyrazol-4-yl)piperidin-3-yl]methyl]but-2-en-1-amine.
| Compound Name | N,3-dimethyl-N-[[(2R,3S)-1-methyl-2-(1-methylpyrazol-4-yl)piperidin-3-yl]methyl]but-2-en-1-amine |
|---|---|
| PubChem CID | 128994586 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | N,3-dimethyl-N-[[(2R,3S)-1-methyl-2-(1-methylpyrazol-4-yl)piperidin-3-yl]methyl]but-2-en-1-amine |
| SMILES | CC(C)=CCN(C)C[C@@H]1CCCN(C)[C@H]1c1cnn(C)c1 |
| InChI | InChI=1S/C17H30N4/c1-14(2)8-10-19(3)12-15-7-6-9-20(4)17(15)16-11-18-21(5)13-16/h8,11,13,15,17H,6-7,9-10,12H2,1-5H3/t15-,17+/m0/s1 |
| InChIKey | YVCQCCVAGDSLBS-DOTOQJQBSA-N |
| XLogP | 2.70 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|