About 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride
5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride (PubChem CID 128995369) has the molecular formula C15H25ClN4
and a molecular weight of 296.85 g/mol. Its IUPAC name is 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride.
Molecular Properties
| Compound Name | 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride |
| PubChem CID | 128995369 |
| Molecular Formula | C15H25ClN4 |
| Molecular Weight | 296.85 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride |
| SMILES | Cl.Nc1ccc(NC2CCCN(CC3CC3)CC2)cn1 |
| InChI | InChI=1S/C15H24N4.ClH/c16-15-6-5-14(10-17-15)18-13-2-1-8-19(9-7-13)11-12-3-4-12;/h5-6,10,12-13,18H,1-4,7-9,11H2,(H2,16,17);1H |
| InChIKey | BLZGHRXLPGMLBM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride?
The IUPAC name of 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride (CID 128995369) is 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride.
What is the SMILES notation for 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride?
The canonical SMILES for 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride is Cl.Nc1ccc(NC2CCCN(CC3CC3)CC2)cn1.
What is the InChIKey of 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride?
The InChIKey is BLZGHRXLPGMLBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4.ClH/c16-15-6-5-14(10-17-15)18-13-2-1-8-19(9-7-13)11-12-3-4-12;/h5-6,10,12-13,18H,1-4,7-9,11H2,(H2,16,17);1H.
What are the key properties of 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride?
5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride has a molecular weight of 296.85 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-[1-(cyclopropylmethyl)azepan-4-yl]pyridine-2,5-diamine;hydrochloride is sourced from PubChem (CID 128995369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).