About 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide
1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide (PubChem CID 128995991) has the molecular formula C14H19N5OS
and a molecular weight of 305.41 g/mol. Its IUPAC name is 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide |
| PubChem CID | 128995991 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide |
| SMILES | O=C(NCCc1cscn1)c1ccn(C2CCCNC2)n1 |
| InChI | InChI=1S/C14H19N5OS/c20-14(16-6-3-11-9-21-10-17-11)13-4-7-19(18-13)12-2-1-5-15-8-12/h4,7,9-10,12,15H,1-3,5-6,8H2,(H,16,20) |
| InChIKey | FAADDLMPDUMJOC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide?
The IUPAC name of 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide (CID 128995991) is 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide.
What is the SMILES notation for 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide?
The canonical SMILES for 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide is O=C(NCCc1cscn1)c1ccn(C2CCCNC2)n1.
What is the InChIKey of 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide?
The InChIKey is FAADDLMPDUMJOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5OS/c20-14(16-6-3-11-9-21-10-17-11)13-4-7-19(18-13)12-2-1-5-15-8-12/h4,7,9-10,12,15H,1-3,5-6,8H2,(H,16,20).
What are the key properties of 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide?
1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide has a molecular weight of 305.41 g/mol, XLogP of 1.24, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-3-yl-N-[2-(1,3-thiazol-4-yl)ethyl]pyrazole-3-carboxamide is sourced from PubChem (CID 128995991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).