C11H21N5O3S — CID 128996618
8-[[ethyl(methyl)sulfamoyl]amino]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 128996618) has the molecular formula C11H21N5O3S and a molecular weight of 303.39 g/mol. Its IUPAC name is 8-[[ethyl(methyl)sulfamoyl]amino]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 8-[[ethyl(methyl)sulfamoyl]amino]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 128996618 |
| Molecular Formula | C11H21N5O3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 8-[[ethyl(methyl)sulfamoyl]amino]-2-(methoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CCN(C)S(=O)(=O)NC1CCCn2nc(COC)nc21 |
| InChI | InChI=1S/C11H21N5O3S/c1-4-15(2)20(17,18)14-9-6-5-7-16-11(9)12-10(13-16)8-19-3/h9,14H,4-8H2,1-3H3 |
| InChIKey | WDTNMNPHQROBHB-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |