About 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide
3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide (PubChem CID 128998358) has the molecular formula C16H20N4O4S
and a molecular weight of 364.43 g/mol. Its IUPAC name is 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide.
Molecular Properties
| Compound Name | 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide |
| PubChem CID | 128998358 |
| Molecular Formula | C16H20N4O4S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide |
| SMILES | CCn1cc([C@H]2OCC[C@@H]2NS(=O)(=O)c2cccc(C(N)=O)c2)cn1 |
| InChI | InChI=1S/C16H20N4O4S/c1-2-20-10-12(9-18-20)15-14(6-7-24-15)19-25(22,23)13-5-3-4-11(8-13)16(17)21/h3-5,8-10,14-15,19H,2,6-7H2,1H3,(H2,17,21)/t14-,15+/m0/s1 |
| InChIKey | IDCHZGRAOXUVOS-LSDHHAIUSA-N |
| XLogP | 0.81 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide?
The IUPAC name of 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide (CID 128998358) is 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide.
What is the SMILES notation for 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide?
The canonical SMILES for 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide is CCn1cc([C@H]2OCC[C@@H]2NS(=O)(=O)c2cccc(C(N)=O)c2)cn1.
What is the InChIKey of 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide?
The InChIKey is IDCHZGRAOXUVOS-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H20N4O4S/c1-2-20-10-12(9-18-20)15-14(6-7-24-15)19-25(22,23)13-5-3-4-11(8-13)16(17)21/h3-5,8-10,14-15,19H,2,6-7H2,1H3,(H2,17,21)/t14-,15+/m0/s1.
What are the key properties of 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide?
3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide has a molecular weight of 364.43 g/mol, XLogP of 0.81, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]sulfamoyl]benzamide is sourced from PubChem (CID 128998358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).