C17H21NO10S2 — CID 12899861
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)oxan-2-yl]methyl acetate (PubChem CID 12899861) has the molecular formula C17H21NO10S2 and a molecular weight of 463.49 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 12899861 |
| Molecular Formula | C17H21NO10S2 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N2C(=O)CSC2=S)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H21NO10S2/c1-7(19)24-5-11-13(25-8(2)20)14(26-9(3)21)15(27-10(4)22)16(28-11)18-12(23)6-30-17(18)29/h11,13-16H,5-6H2,1-4H3/t11-,13-,14+,15-,16-/m1/s1 |
| InChIKey | LORNUQHGUJPMDH-YMILTQATSA-N |
| XLogP | -0.07 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|