C15H17BrN4O2S — CID 128999181
(E)-2-(3-bromophenyl)-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)ethenesulfonamide (PubChem CID 128999181) has the molecular formula C15H17BrN4O2S and a molecular weight of 397.30 g/mol. Its IUPAC name is (E)-2-(3-bromophenyl)-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)ethenesulfonamide.
| Compound Name | (E)-2-(3-bromophenyl)-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)ethenesulfonamide |
|---|---|
| PubChem CID | 128999181 |
| Molecular Formula | C15H17BrN4O2S |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | (E)-2-(3-bromophenyl)-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)ethenesulfonamide |
| SMILES | Cc1nc2n(n1)CCCC2NS(=O)(=O)/C=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C15H17BrN4O2S/c1-11-17-15-14(6-3-8-20(15)18-11)19-23(21,22)9-7-12-4-2-5-13(16)10-12/h2,4-5,7,9-10,14,19H,3,6,8H2,1H3/b9-7+ |
| InChIKey | IIYIYEOBYOIFAT-VQHVLOKHSA-N |
| XLogP | 2.77 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |