About 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine
1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine (PubChem CID 128999830) has the molecular formula C19H29NO2
and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine |
| PubChem CID | 128999830 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine |
| SMILES | CC(CC1CCOCC1)NC[C@H]1CCO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H29NO2/c1-15(13-16-7-10-21-11-8-16)20-14-18-9-12-22-19(18)17-5-3-2-4-6-17/h2-6,15-16,18-20H,7-14H2,1H3/t15?,18-,19-/m1/s1 |
| InChIKey | LNOSTFZNWLSRBO-JCNKGUCWSA-N |
| XLogP | 3.56 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine?
The IUPAC name of 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine (CID 128999830) is 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine.
What is the SMILES notation for 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine?
The canonical SMILES for 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine is CC(CC1CCOCC1)NC[C@H]1CCO[C@@H]1c1ccccc1.
What is the InChIKey of 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine?
The InChIKey is LNOSTFZNWLSRBO-JCNKGUCWSA-N. The full InChI is InChI=1S/C19H29NO2/c1-15(13-16-7-10-21-11-8-16)20-14-18-9-12-22-19(18)17-5-3-2-4-6-17/h2-6,15-16,18-20H,7-14H2,1H3/t15?,18-,19-/m1/s1.
What are the key properties of 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine?
1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine has a molecular weight of 303.45 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-4-yl)-N-[[(2S,3R)-2-phenyloxolan-3-yl]methyl]propan-2-amine is sourced from PubChem (CID 128999830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).