C18H25N5O2 — CID 129000681
(4R,5S)-5-(1,5-dimethylpyrazol-4-yl)-1-methyl-4-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylamino)pyrrolidin-2-one (PubChem CID 129000681) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is (4R,5S)-5-(1,5-dimethylpyrazol-4-yl)-1-methyl-4-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylamino)pyrrolidin-2-one.
| Compound Name | (4R,5S)-5-(1,5-dimethylpyrazol-4-yl)-1-methyl-4-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylamino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 129000681 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | (4R,5S)-5-(1,5-dimethylpyrazol-4-yl)-1-methyl-4-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-ylmethylamino)pyrrolidin-2-one |
| SMILES | Cc1c([C@H]2[C@H](NCc3noc4c3CCCC4)CC(=O)N2C)cnn1C |
| InChI | InChI=1S/C18H25N5O2/c1-11-13(9-20-23(11)3)18-14(8-17(24)22(18)2)19-10-15-12-6-4-5-7-16(12)25-21-15/h9,14,18-19H,4-8,10H2,1-3H3/t14-,18+/m1/s1 |
| InChIKey | QZICNZFRLXJVQZ-KDOFPFPSSA-N |
| XLogP | 1.66 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |