About 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide
3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide (PubChem CID 129000828) has the molecular formula C16H23N5O2
and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide |
| PubChem CID | 129000828 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide |
| SMILES | CCc1nn(C)cc1C(=O)N[C@H]1CCCO[C@@H]1c1cnn(C)c1 |
| InChI | InChI=1S/C16H23N5O2/c1-4-13-12(10-21(3)19-13)16(22)18-14-6-5-7-23-15(14)11-8-17-20(2)9-11/h8-10,14-15H,4-7H2,1-3H3,(H,18,22)/t14-,15+/m0/s1 |
| InChIKey | UHXYGWYTNHDREJ-LSDHHAIUSA-N |
| XLogP | 1.37 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide?
The IUPAC name of 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide (CID 129000828) is 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide.
What is the SMILES notation for 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide?
The canonical SMILES for 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide is CCc1nn(C)cc1C(=O)N[C@H]1CCCO[C@@H]1c1cnn(C)c1.
What is the InChIKey of 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide?
The InChIKey is UHXYGWYTNHDREJ-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H23N5O2/c1-4-13-12(10-21(3)19-13)16(22)18-14-6-5-7-23-15(14)11-8-17-20(2)9-11/h8-10,14-15H,4-7H2,1-3H3,(H,18,22)/t14-,15+/m0/s1.
What are the key properties of 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide?
3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide has a molecular weight of 317.39 g/mol, XLogP of 1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methyl-N-[(2R,3S)-2-(1-methylpyrazol-4-yl)oxan-3-yl]pyrazole-4-carboxamide is sourced from PubChem (CID 129000828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).