C17H21F3N4O2 — CID 129001125
2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]acetamide (PubChem CID 129001125) has the molecular formula C17H21F3N4O2 and a molecular weight of 370.38 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]acetamide |
|---|---|
| PubChem CID | 129001125 |
| Molecular Formula | C17H21F3N4O2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-(3,5-dimethyl-1,2-oxazol-4-yl)-N-methyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]acetamide |
| SMILES | Cc1noc(C)c1CC(=O)N(C)CC1CCc2nc(C(F)(F)F)cn2C1 |
| InChI | InChI=1S/C17H21F3N4O2/c1-10-13(11(2)26-22-10)6-16(25)23(3)7-12-4-5-15-21-14(17(18,19)20)9-24(15)8-12/h9,12H,4-8H2,1-3H3 |
| InChIKey | WAODKEVOLHYHOK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |