C16H22N4O2S — CID 129001149
N,1-dimethyl-N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide (PubChem CID 129001149) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is N,1-dimethyl-N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide.
| Compound Name | N,1-dimethyl-N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
|---|---|
| PubChem CID | 129001149 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N,1-dimethyl-N-[(2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl)methyl]-6-oxo-4,5-dihydropyridazine-3-carboxamide |
| SMILES | Cc1nc2c(s1)CCCC2CN(C)C(=O)C1=NN(C)C(=O)CC1 |
| InChI | InChI=1S/C16H22N4O2S/c1-10-17-15-11(5-4-6-13(15)23-10)9-19(2)16(22)12-7-8-14(21)20(3)18-12/h11H,4-9H2,1-3H3 |
| InChIKey | TVRQTTIOWXGBEG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 65.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |