C13H16F3N5S — CID 129002269
3-ethyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,2,4-thiadiazol-5-amine (PubChem CID 129002269) has the molecular formula C13H16F3N5S and a molecular weight of 331.37 g/mol. Its IUPAC name is 3-ethyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-ethyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 129002269 |
| Molecular Formula | C13H16F3N5S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-ethyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1,2,4-thiadiazol-5-amine |
| SMILES | CCc1nsc(NCC2CCc3nc(C(F)(F)F)cn3C2)n1 |
| InChI | InChI=1S/C13H16F3N5S/c1-2-10-19-12(22-20-10)17-5-8-3-4-11-18-9(13(14,15)16)7-21(11)6-8/h7-8H,2-6H2,1H3,(H,17,19,20) |
| InChIKey | KHUJDBLEFCFONY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |