C22H31N5O — CID 129003849
(4S,5R)-1-methyl-5-(1-methylpyrazol-4-yl)-4-[[(4-piperidin-1-ylphenyl)methylamino]methyl]pyrrolidin-2-one (PubChem CID 129003849) has the molecular formula C22H31N5O and a molecular weight of 381.52 g/mol. Its IUPAC name is (4S,5R)-1-methyl-5-(1-methylpyrazol-4-yl)-4-[[(4-piperidin-1-ylphenyl)methylamino]methyl]pyrrolidin-2-one.
| Compound Name | (4S,5R)-1-methyl-5-(1-methylpyrazol-4-yl)-4-[[(4-piperidin-1-ylphenyl)methylamino]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 129003849 |
| Molecular Formula | C22H31N5O |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | (4S,5R)-1-methyl-5-(1-methylpyrazol-4-yl)-4-[[(4-piperidin-1-ylphenyl)methylamino]methyl]pyrrolidin-2-one |
| SMILES | CN1C(=O)C[C@@H](CNCc2ccc(N3CCCCC3)cc2)[C@@H]1c1cnn(C)c1 |
| InChI | InChI=1S/C22H31N5O/c1-25-16-19(15-24-25)22-18(12-21(28)26(22)2)14-23-13-17-6-8-20(9-7-17)27-10-4-3-5-11-27/h6-9,15-16,18,22-23H,3-5,10-14H2,1-2H3/t18-,22+/m0/s1 |
| InChIKey | MVDGXUAYHCUCMV-PGRDOPGGSA-N |
| XLogP | 2.72 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|