C13H18F3N5O3 — CID 129004218
5-[(1-propan-2-yltriazol-4-yl)methyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidine-2,4-dione (PubChem CID 129004218) has the molecular formula C13H18F3N5O3 and a molecular weight of 349.31 g/mol. Its IUPAC name is 5-[(1-propan-2-yltriazol-4-yl)methyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(1-propan-2-yltriazol-4-yl)methyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 129004218 |
| Molecular Formula | C13H18F3N5O3 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 5-[(1-propan-2-yltriazol-4-yl)methyl]-3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazolidine-2,4-dione |
| SMILES | CC(C)n1cc(CC2NC(=O)N(CCOCC(F)(F)F)C2=O)nn1 |
| InChI | InChI=1S/C13H18F3N5O3/c1-8(2)21-6-9(18-19-21)5-10-11(22)20(12(23)17-10)3-4-24-7-13(14,15)16/h6,8,10H,3-5,7H2,1-2H3,(H,17,23) |
| InChIKey | XTVHEUMZFRVKGQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|