C15H18F3N5O — CID 129004799
2,5-dimethyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]pyrazole-3-carboxamide (PubChem CID 129004799) has the molecular formula C15H18F3N5O and a molecular weight of 341.34 g/mol. Its IUPAC name is 2,5-dimethyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 129004799 |
| Molecular Formula | C15H18F3N5O |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2,5-dimethyl-N-[[2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC2CCc3nc(C(F)(F)F)cn3C2)n(C)n1 |
| InChI | InChI=1S/C15H18F3N5O/c1-9-5-11(22(2)21-9)14(24)19-6-10-3-4-13-20-12(15(16,17)18)8-23(13)7-10/h5,8,10H,3-4,6-7H2,1-2H3,(H,19,24) |
| InChIKey | YQZDQKRQKPCXBT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |