C19H24N4O3S — CID 129004972
N,3,3-trimethyl-2-oxo-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)-1H-indole-5-sulfonamide (PubChem CID 129004972) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is N,3,3-trimethyl-2-oxo-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)-1H-indole-5-sulfonamide.
| Compound Name | N,3,3-trimethyl-2-oxo-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 129004972 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N,3,3-trimethyl-2-oxo-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-2-ylmethyl)-1H-indole-5-sulfonamide |
| SMILES | CN(Cc1cn2c(n1)CCCC2)S(=O)(=O)c1ccc2c(c1)C(C)(C)C(=O)N2 |
| InChI | InChI=1S/C19H24N4O3S/c1-19(2)15-10-14(7-8-16(15)21-18(19)24)27(25,26)22(3)11-13-12-23-9-5-4-6-17(23)20-13/h7-8,10,12H,4-6,9,11H2,1-3H3,(H,21,24) |
| InChIKey | FNLPEILGJKKRJG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |