About 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide
3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide (PubChem CID 129005291) has the molecular formula C16H17ClN4O3S
and a molecular weight of 380.86 g/mol. Its IUPAC name is 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide |
| PubChem CID | 129005291 |
| Molecular Formula | C16H17ClN4O3S |
| Molecular Weight | 380.86 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide |
| SMILES | CCn1cc([C@H]2OCC[C@@H]2NS(=O)(=O)c2ccc(C#N)c(Cl)c2)cn1 |
| InChI | InChI=1S/C16H17ClN4O3S/c1-2-21-10-12(9-19-21)16-15(5-6-24-16)20-25(22,23)13-4-3-11(8-18)14(17)7-13/h3-4,7,9-10,15-16,20H,2,5-6H2,1H3/t15-,16+/m0/s1 |
| InChIKey | BOWZCHWPSJHDDH-JKSUJKDBSA-N |
| XLogP | 2.24 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.86 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide?
The IUPAC name of 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide (CID 129005291) is 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide.
What is the SMILES notation for 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide?
The canonical SMILES for 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide is CCn1cc([C@H]2OCC[C@@H]2NS(=O)(=O)c2ccc(C#N)c(Cl)c2)cn1.
What is the InChIKey of 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide?
The InChIKey is BOWZCHWPSJHDDH-JKSUJKDBSA-N. The full InChI is InChI=1S/C16H17ClN4O3S/c1-2-21-10-12(9-19-21)16-15(5-6-24-16)20-25(22,23)13-4-3-11(8-18)14(17)7-13/h3-4,7,9-10,15-16,20H,2,5-6H2,1H3/t15-,16+/m0/s1.
What are the key properties of 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide?
3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide has a molecular weight of 380.86 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-cyano-N-[(2R,3S)-2-(1-ethylpyrazol-4-yl)oxolan-3-yl]benzenesulfonamide is sourced from PubChem (CID 129005291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).