C15H23F3N4O2 — CID 129005556
(4R,5S)-1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]-5-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one (PubChem CID 129005556) has the molecular formula C15H23F3N4O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is (4R,5S)-1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]-5-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one.
| Compound Name | (4R,5S)-1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]-5-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 129005556 |
| Molecular Formula | C15H23F3N4O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (4R,5S)-1-methyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]-5-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one |
| SMILES | Cc1nn(C)c(C)c1[C@H]1[C@H](NCCOCC(F)(F)F)CC(=O)N1C |
| InChI | InChI=1S/C15H23F3N4O2/c1-9-13(10(2)22(4)20-9)14-11(7-12(23)21(14)3)19-5-6-24-8-15(16,17)18/h11,14,19H,5-8H2,1-4H3/t11-,14-/m1/s1 |
| InChIKey | WVBJBFXSJPNTEI-BXUZGUMPSA-N |
| XLogP | 1.48 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|