C13H18F3N3O2 — CID 129006621
N-methyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 129006621) has the molecular formula C13H18F3N3O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is N-methyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-methyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 129006621 |
| Molecular Formula | C13H18F3N3O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-methyl-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-ylmethyl)-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | CN(CC1CCn2ccnc2C1)C(=O)COCC(F)(F)F |
| InChI | InChI=1S/C13H18F3N3O2/c1-18(12(20)8-21-9-13(14,15)16)7-10-2-4-19-5-3-17-11(19)6-10/h3,5,10H,2,4,6-9H2,1H3 |
| InChIKey | WIXOMSIAIPHPIQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |