C18H26N6O2 — CID 129007192
2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-4-ethyl-5-[(2S,3R)-3-methyloxolan-2-yl]-1,2,4-triazol-3-one (PubChem CID 129007192) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-4-ethyl-5-[(2S,3R)-3-methyloxolan-2-yl]-1,2,4-triazol-3-one.
| Compound Name | 2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-4-ethyl-5-[(2S,3R)-3-methyloxolan-2-yl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 129007192 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 2-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-4-ethyl-5-[(2S,3R)-3-methyloxolan-2-yl]-1,2,4-triazol-3-one |
| SMILES | CCn1c([C@H]2OCC[C@H]2C)nn(Cc2nnc(C3CC3)n2C2CC2)c1=O |
| InChI | InChI=1S/C18H26N6O2/c1-3-22-17(15-11(2)8-9-26-15)21-23(18(22)25)10-14-19-20-16(12-4-5-12)24(14)13-6-7-13/h11-13,15H,3-10H2,1-2H3/t11-,15+/m1/s1 |
| InChIKey | XRUODHKOJPNMRX-ABAIWWIYSA-N |
| XLogP | 2.01 |
| TPSA | 79.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |