C15H24O — CID 12900740
(1R,3E,7E,11S)-1,5,5,8-tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-diene (PubChem CID 12900740) has the molecular formula C15H24O and a molecular weight of 220.35 g/mol. Its IUPAC name is (1R,3E,7E,11S)-1,5,5,8-tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-diene.
| Compound Name | (1R,3E,7E,11S)-1,5,5,8-tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-diene |
|---|---|
| PubChem CID | 12900740 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (1R,3E,7E,11S)-1,5,5,8-tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-diene |
| SMILES | C/C/1=C\CC(/C=C/C[C@@]2([C@@H](O2)CC1)C)(C)C |
| InChI | InChI=1S/C15H24O/c1-12-6-7-13-15(4,16-13)10-5-9-14(2,3)11-8-12/h5,8-9,13H,6-7,10-11H2,1-4H3/b9-5+,12-8+/t13-,15+/m0/s1 |
| InChIKey | QTGAEXCCAPTGLB-RWRNEBBCSA-N |
| XLogP | 3.80 |
| TPSA | 12.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | 324 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|