C18H23FN2O4 — CID 129008340
2-[cyclopropylmethyl-[3-[(2-fluoro-6-methoxybenzoyl)amino]cyclobutyl]amino]acetic acid (PubChem CID 129008340) has the molecular formula C18H23FN2O4 and a molecular weight of 350.39 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-[(2-fluoro-6-methoxybenzoyl)amino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-[(2-fluoro-6-methoxybenzoyl)amino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 129008340 |
| Molecular Formula | C18H23FN2O4 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-[(2-fluoro-6-methoxybenzoyl)amino]cyclobutyl]amino]acetic acid |
| SMILES | COc1cccc(F)c1C(=O)NC1CC(N(CC(=O)O)CC2CC2)C1 |
| InChI | InChI=1S/C18H23FN2O4/c1-25-15-4-2-3-14(19)17(15)18(24)20-12-7-13(8-12)21(10-16(22)23)9-11-5-6-11/h2-4,11-13H,5-10H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | YEXYADBXYVPCAT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |