C11H22O6 — CID 12900879
(2S,3R,4S,5S,6R)-2,3,4,5-tetramethoxy-6-(methoxymethyl)oxane (PubChem CID 12900879) has the molecular formula C11H22O6 and a molecular weight of 250.29 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2,3,4,5-tetramethoxy-6-(methoxymethyl)oxane.
| Compound Name | (2S,3R,4S,5S,6R)-2,3,4,5-tetramethoxy-6-(methoxymethyl)oxane |
|---|---|
| PubChem CID | 12900879 |
| Molecular Formula | C11H22O6 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2,3,4,5-tetramethoxy-6-(methoxymethyl)oxane |
| SMILES | COC[C@H]1O[C@H](OC)[C@H](OC)[C@@H](OC)[C@H]1OC |
| InChI | InChI=1S/C11H22O6/c1-12-6-7-8(13-2)9(14-3)10(15-4)11(16-5)17-7/h7-11H,6H2,1-5H3/t7-,8+,9+,10-,11+/m1/s1 |
| InChIKey | ZYGZAHUNAGVTEC-KJPMQGKISA-N |
| XLogP | 0.05 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |