C15H19NO4S — CID 129009112
(2E,4E)-1-[3-(5-methylfuran-2-yl)-1,1-dioxo-1,4-thiazinan-4-yl]hexa-2,4-dien-1-one (PubChem CID 129009112) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is (2E,4E)-1-[3-(5-methylfuran-2-yl)-1,1-dioxo-1,4-thiazinan-4-yl]hexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-[3-(5-methylfuran-2-yl)-1,1-dioxo-1,4-thiazinan-4-yl]hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 129009112 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (2E,4E)-1-[3-(5-methylfuran-2-yl)-1,1-dioxo-1,4-thiazinan-4-yl]hexa-2,4-dien-1-one |
| SMILES | C/C=C/C=C/C(=O)N1CCS(=O)(=O)CC1c1ccc(C)o1 |
| InChI | InChI=1S/C15H19NO4S/c1-3-4-5-6-15(17)16-9-10-21(18,19)11-13(16)14-8-7-12(2)20-14/h3-8,13H,9-11H2,1-2H3/b4-3+,6-5+ |
| InChIKey | LFABWIZLINIHOQ-VNKDHWASSA-N |
| XLogP | 2.02 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|