About 5-undecyl-1,2-dihydropyrrol-3-one
5-undecyl-1,2-dihydropyrrol-3-one (PubChem CID 129009747) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is 5-undecyl-1,2-dihydropyrrol-3-one.
Molecular Properties
| Compound Name | 5-undecyl-1,2-dihydropyrrol-3-one |
| PubChem CID | 129009747 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 5-undecyl-1,2-dihydropyrrol-3-one |
| SMILES | CCCCCCCCCCCC1=CC(=O)CN1 |
| InChI | InChI=1S/C15H27NO/c1-2-3-4-5-6-7-8-9-10-11-14-12-15(17)13-16-14/h12,16H,2-11,13H2,1H3 |
| InChIKey | ZUNBINDVXKAJIF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-undecyl-1,2-dihydropyrrol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-undecyl-1,2-dihydropyrrol-3-one?
The IUPAC name of 5-undecyl-1,2-dihydropyrrol-3-one (CID 129009747) is 5-undecyl-1,2-dihydropyrrol-3-one.
What is the SMILES notation for 5-undecyl-1,2-dihydropyrrol-3-one?
The canonical SMILES for 5-undecyl-1,2-dihydropyrrol-3-one is CCCCCCCCCCCC1=CC(=O)CN1.
What is the InChIKey of 5-undecyl-1,2-dihydropyrrol-3-one?
The InChIKey is ZUNBINDVXKAJIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO/c1-2-3-4-5-6-7-8-9-10-11-14-12-15(17)13-16-14/h12,16H,2-11,13H2,1H3.
What are the key properties of 5-undecyl-1,2-dihydropyrrol-3-one?
5-undecyl-1,2-dihydropyrrol-3-one has a molecular weight of 237.39 g/mol, XLogP of 3.96, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-undecyl-1,2-dihydropyrrol-3-one is sourced from PubChem (CID 129009747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).