C18H22N2S — CID 129009771
2,2,3,3,5,5,6,6-octadeuterio-1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine (PubChem CID 129009771) has the molecular formula C18H22N2S and a molecular weight of 306.50 g/mol. Its IUPAC name is 2,2,3,3,5,5,6,6-octadeuterio-1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine.
| Compound Name | 2,2,3,3,5,5,6,6-octadeuterio-1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine |
|---|---|
| PubChem CID | 129009771 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 2,2,3,3,5,5,6,6-octadeuterio-1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine |
| SMILES | [2H]C1([2H])NC([2H])([2H])C([2H])([2H])N(c2ccccc2Sc2ccc(C)cc2C)C1([2H])[2H] |
| InChI | InChI=1S/C18H22N2S/c1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20/h3-8,13,19H,9-12H2,1-2H3/i9D2,10D2,11D2,12D2 |
| InChIKey | YQNWZWMKLDQSAC-PMCMNDOISA-N |
| XLogP | 3.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |