C14H21N2O16P3 — CID 129010124
[[(2R,3S,5R)-5-[4-[(4R)-4,5-dihydroxypent-1-ynyl]-2-nitropyrrol-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 129010124) has the molecular formula C14H21N2O16P3 and a molecular weight of 566.24 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-[4-[(4R)-4,5-dihydroxypent-1-ynyl]-2-nitropyrrol-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-[4-[(4R)-4,5-dihydroxypent-1-ynyl]-2-nitropyrrol-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 129010124 |
| Molecular Formula | C14H21N2O16P3 |
| Molecular Weight | 566.24 g/mol |
| Exact Mass | 566.01 |
| IUPAC Name | [[(2R,3S,5R)-5-[4-[(4R)-4,5-dihydroxypent-1-ynyl]-2-nitropyrrol-1-yl]-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=[N+]([O-])c1cc(C#CC[C@@H](O)CO)cn1[C@H]1C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O1 |
| InChI | InChI=1S/C14H21N2O16P3/c17-7-10(18)3-1-2-9-4-13(16(20)21)15(6-9)14-5-11(19)12(30-14)8-29-34(25,26)32-35(27,28)31-33(22,23)24/h4,6,10-12,14,17-19H,3,5,7-8H2,(H,25,26)(H,27,28)(H2,22,23,24)/t10-,11+,12-,14-/m1/s1 |
| InChIKey | JIVPAQSXWIKFCI-GFQSEFKGSA-N |
| XLogP | -0.52 |
| TPSA | 277.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.24 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|