C19H28N4O2 — CID 129010540
2-[[4-(3-hydroxyphenyl)piperazin-1-yl]methyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one (PubChem CID 129010540) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[[4-(3-hydroxyphenyl)piperazin-1-yl]methyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one.
| Compound Name | 2-[[4-(3-hydroxyphenyl)piperazin-1-yl]methyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 129010540 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 2-[[4-(3-hydroxyphenyl)piperazin-1-yl]methyl]-2,3,4a,5,6,7,8,8a-octahydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(CN2CCN(c3cccc(O)c3)CC2)NC2CCCCC12 |
| InChI | InChI=1S/C19H28N4O2/c24-15-5-3-4-14(12-15)23-10-8-22(9-11-23)13-18-20-17-7-2-1-6-16(17)19(25)21-18/h3-5,12,16-18,20,24H,1-2,6-11,13H2,(H,21,25) |
| InChIKey | ZXNJMTSJYHXJFE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |