C22H24N6O3 — CID 129010568
2-[3-[4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]propyl]isoindole-1,3-dione (PubChem CID 129010568) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-[3-[4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 129010568 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-[3-[4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]propyl]isoindole-1,3-dione |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1ccc(OCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H24N6O3/c1-22(2)26-20(23)25-21(24)28(22)14-8-10-15(11-9-14)31-13-5-12-27-18(29)16-6-3-4-7-17(16)19(27)30/h3-4,6-11H,5,12-13H2,1-2H3,(H4,23,24,25,26) |
| InChIKey | WNTSSRXPGNMWTQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|