C23H26N6O3 — CID 129010569
2-[4-[4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]butyl]isoindole-1,3-dione (PubChem CID 129010569) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[4-[4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 129010569 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 2-[4-[4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1-yl)phenoxy]butyl]isoindole-1,3-dione |
| SMILES | CC1(C)N=C(N)N=C(N)N1c1ccc(OCCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H26N6O3/c1-23(2)27-21(24)26-22(25)29(23)15-9-11-16(12-10-15)32-14-6-5-13-28-19(30)17-7-3-4-8-18(17)20(28)31/h3-4,7-12H,5-6,13-14H2,1-2H3,(H4,24,25,26,27) |
| InChIKey | QHWWRXXNZGFBKU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|