C30H37FN4O3S — CID 129010669
N-[(1R,3S)-3-[(2-fluoro-6-methoxyphenyl)methyl]-3-hydroxycyclohexyl]-3-(2-methyl-1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 129010669) has the molecular formula C30H37FN4O3S and a molecular weight of 552.72 g/mol. Its IUPAC name is N-[(1R,3S)-3-[(2-fluoro-6-methoxyphenyl)methyl]-3-hydroxycyclohexyl]-3-(2-methyl-1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(1R,3S)-3-[(2-fluoro-6-methoxyphenyl)methyl]-3-hydroxycyclohexyl]-3-(2-methyl-1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 129010669 |
| Molecular Formula | C30H37FN4O3S |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | N-[(1R,3S)-3-[(2-fluoro-6-methoxyphenyl)methyl]-3-hydroxycyclohexyl]-3-(2-methyl-1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | COc1cccc(F)c1C[C@@]1(O)CCC[C@@H](NC(=O)C2CCC3NNC(c4ccc5nc(C)sc5c4)C3C2)C1 |
| InChI | InChI=1S/C30H37FN4O3S/c1-17-32-25-11-8-18(14-27(25)39-17)28-21-13-19(9-10-24(21)34-35-28)29(36)33-20-5-4-12-30(37,15-20)16-22-23(31)6-3-7-26(22)38-2/h3,6-8,11,14,19-21,24,28,34-35,37H,4-5,9-10,12-13,15-16H2,1-2H3,(H,33,36)/t19?,20-,21?,24?,28?,30-/m1/s1 |
| InChIKey | NLKGWWUVGGQYLI-PZNQDUMSSA-N |
| XLogP | 4.72 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |