C18H14F3N3O — CID 129010744
N-[3-(4-methoxyphenyl)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 129010744) has the molecular formula C18H14F3N3O and a molecular weight of 345.32 g/mol. Its IUPAC name is N-[3-(4-methoxyphenyl)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[3-(4-methoxyphenyl)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 129010744 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[3-(4-methoxyphenyl)phenyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | COc1ccc(-c2cccc(Nc3nccc(C(F)(F)F)n3)c2)cc1 |
| InChI | InChI=1S/C18H14F3N3O/c1-25-15-7-5-12(6-8-15)13-3-2-4-14(11-13)23-17-22-10-9-16(24-17)18(19,20)21/h2-11H,1H3,(H,22,23,24) |
| InChIKey | IMKJTBRUBXJYPV-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |