C29H33F6N3O5S — CID 129010867
(2S)-N-cyclopropylsulfonyl-6-oxo-4-(1-propan-2-ylpyrrol-3-yl)-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 129010867) has the molecular formula C29H33F6N3O5S and a molecular weight of 649.65 g/mol. Its IUPAC name is (2S)-N-cyclopropylsulfonyl-6-oxo-4-(1-propan-2-ylpyrrol-3-yl)-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | (2S)-N-cyclopropylsulfonyl-6-oxo-4-(1-propan-2-ylpyrrol-3-yl)-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 129010867 |
| Molecular Formula | C29H33F6N3O5S |
| Molecular Weight | 649.65 g/mol |
| Exact Mass | 649.20 |
| IUPAC Name | (2S)-N-cyclopropylsulfonyl-6-oxo-4-(1-propan-2-ylpyrrol-3-yl)-2-[4-(6,6,6-trifluorohexoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | CC(C)n1ccc(C2=C(C(=O)NS(=O)(=O)C3CC3)C(=O)N[C@@](c3ccc(OCCCCCC(F)(F)F)cc3)(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C29H33F6N3O5S/c1-18(2)38-14-12-19(17-38)23-16-27(29(33,34)35,36-25(39)24(23)26(40)37-44(41,42)22-10-11-22)20-6-8-21(9-7-20)43-15-5-3-4-13-28(30,31)32/h6-9,12,14,17-18,22H,3-5,10-11,13,15-16H2,1-2H3,(H,36,39)(H,37,40)/t27-/m0/s1 |
| InChIKey | RFNZRFDWUNDTQN-MHZLTWQESA-N |
| XLogP | 5.91 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.65 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|