C24H36CaN4O6+2 — CID 129010967
calcium bis(5-pentan-2-yl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione) (PubChem CID 129010967) has the molecular formula C24H36CaN4O6+2 and a molecular weight of 516.65 g/mol. Its IUPAC name is calcium bis(5-pentan-2-yl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione).
| Compound Name | calcium bis(5-pentan-2-yl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione) |
|---|---|
| PubChem CID | 129010967 |
| Molecular Formula | C24H36CaN4O6+2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | calcium bis(5-pentan-2-yl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione) |
| SMILES | C=CCC1(C(C)CCC)C(=O)NC(=O)NC1=O.C=CCC1(C(C)CCC)C(=O)NC(=O)NC1=O.[Ca+2] |
| InChI | InChI=1S/2C12H18N2O3.Ca/c2*1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16;/h2*5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17);/q;;+2 |
| InChIKey | FQKQHOLZWWACIV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|