About 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one
1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one (PubChem CID 129011355) has the molecular formula C10H9BO3
and a molecular weight of 187.99 g/mol. Its IUPAC name is 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one.
Molecular Properties
| Compound Name | 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one |
| PubChem CID | 129011355 |
| Molecular Formula | C10H9BO3 |
| Molecular Weight | 187.99 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one |
| SMILES | O=C1CCc2c1ccc1c2B(O)OC1 |
| InChI | InChI=1S/C10H9BO3/c12-9-4-3-8-7(9)2-1-6-5-14-11(13)10(6)8/h1-2,13H,3-5H2 |
| InChIKey | ILZISGAMVFLFJK-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.99 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one?
The IUPAC name of 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one (CID 129011355) is 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one.
What is the SMILES notation for 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one?
The canonical SMILES for 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one is O=C1CCc2c1ccc1c2B(O)OC1.
What is the InChIKey of 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one?
The InChIKey is ILZISGAMVFLFJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BO3/c12-9-4-3-8-7(9)2-1-6-5-14-11(13)10(6)8/h1-2,13H,3-5H2.
What are the key properties of 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one?
1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one has a molecular weight of 187.99 g/mol, XLogP of 0.03, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-7,8-dihydro-3H-cyclopenta[g][2,1]benzoxaborol-6-one is sourced from PubChem (CID 129011355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).